| Catalog Number |
ACM74079008 |
| CAS |
74079-00-8 |
| Structure |
 |
| Synonyms |
Hydroquinone Dimethylether; p-Methoxyanisole |
| IUPAC Name |
1,2,4,5-tetradeuterio-3,6-bis(trideuteriomethoxy)benzene |
| Molecular Weight |
148.23 |
| Molecular Formula |
C6D4(OCD3)2 |
| Canonical SMILES |
COC1=CC=C(C=C1)OC |
| InChI |
InChI=1S/C8H10O2/c1-9-7-3-5-8(10-2)6-4-7/h3-6H,1-2H3/i1D3,2D3,3D,4D,5D,6D |
| InChI Key |
OHBQPCCCRFSCAX-ZGYYUIRESA-N |
| Purity |
98 atom % D |
| Chemical Formula |
C6D4(OCD3)2 |
| Exact Mass |
148.130847017 |
| Functional Group |
Ethers & Oxides |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1OC([2H])([2H])[2H])[2H])[2H])OC([2H])([2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Monoisotopic Mass |
148.130847017 |
| Packaging |
0.1 g
In Stock
0.25 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
150-78-7 |
| Unlabeled Synonyms |
Hydroquinone dimethylether; p-Methoxyanisole |
