| Catalog Number |
ACM362049432 |
| CAS |
362049-43-2 |
| Structure |
 |
| Synonyms |
o-Dimethoxybenzene, Veratrole, Catechol Dimethyl Ether, Pyrocathecol Dimethyl Ether |
| IUPAC Name |
1,1,2,2,3,3,4,4,5,6-decadeuterio-5,6-dimethoxycyclohexane |
| Molecular Weight |
148.23 |
| Molecular Formula |
C6D4(OCD3)2 |
| Canonical SMILES |
COC1=CC=CC=C1OC |
| InChI |
InChI=1S/C8H16O2/c1-9-7-5-3-4-6-8(7)10-2/h7-8H,3-6H2,1-2H3/i3D2,4D2,5D2,6D2,7D,8D |
| InChI Key |
BSGBGTJQKZSUTQ-UPEVGZBISA-N |
| Purity |
99 atom % D |
| Chemical Formula |
C6D4(OCD3)2 |
| Exact Mass |
148.13100 |
| Functional Group |
Ethers & Oxides |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1(C(C(C(C(C1([2H])[2H])([2H])OC)([2H])OC)([2H])[2H])([2H])[2H])[2H] |
| Isotopic Enrichment |
99 atom % D |
| Packaging |
0.25 g
In Stock
0.5 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
91-16-7 |
| Unlabeled Synonyms |
o-Dimethoxybenzene |
