| Catalog Number |
ACM24658240-1 |
| CAS |
24658-24-0 |
| Structure |
 |
| Synonyms |
o-Dimethoxybenzene, Veratrole, Catechol Dimethyl Ether, Pyrocathecol Dimethyl Ether |
| IUPAC Name |
1,2-bis(trideuteriomethoxy)benzene |
| Molecular Weight |
144.2 |
| Molecular Formula |
C6H4(OCD3)2 |
| InChI |
InChI=1S/C8H10O2/c1-9-7-5-3-4-6-8(7)10-2/h3-6H,1-2H3/i1D3,2D3 |
| InChI Key |
ABDKAPXRBAPSQN-WFGJKAKNSA-N |
| Appearance |
Yellow oil |
| Chemical Formula |
C6H4(OCD3)2 |
| Functional Group |
Ethers & Oxides |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])OC1=CC=CC=C1OC([2H])([2H])[2H] |
| Isotopic Enrichment |
99 atom % D |
| Packaging |
0.5 g
In Stock
1 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
91-16-7 |
| Unlabeled Synonyms |
o-Dimethoxybenzene |
