Dimethoate D6 (O,O dimethyl D6)
| Catalog Number |
ACM1219794816-1 |
| CAS |
1219794-81-6 |
| Structure |
 |
| Synonyms |
Dimethoate (O,O-dimethyl-D6) |
| IUPAC Name |
2-[bis(trideuteriomethoxy)phosphinothioylsulfanyl]-N-methylacetamide |
| Molecular Weight |
235.29 |
| Molecular Formula |
C5D6H6NO3PS2 |
| Canonical SMILES |
[2H]C([2H])([2H])OP(=S)(OC([2H])([2H])[2H])SCC(=O)NC |
| InChI |
InChI=1S/C5H12NO3PS2/c1-6-5(7)4-12-10(11,8-2)9-3/h4H2,1-3H3,(H,6,7)/i2D3,3D3 |
| Storage |
-18 °C |
| Accurate Mass |
235.0373 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
60-51-5 |
Please kindly note that our products and services are for research use only.
