4,6-Dihydroxypyrazolo[3,4-d]pyrimidine-13C,15N2
| Catalog Number |
ACM1217036719 |
| CAS |
1217036-71-9 |
| Structure |
 |
| IUPAC Name |
1,2-dihydro(5^{13}C,1,2-^{15}N_{2})pyrazolo[3,4-d]pyrimidine-4,6-dione |
| Molecular Weight |
155.09 |
| Molecular Formula |
13CC4H415N2N2O2 |
| Canonical SMILES |
O=C1NC(=O)C2=[13CH][15NH][15NH]C2=N1 |
| InChI |
InChI=1S/C5H4N4O2/c10-4-2-1-6-9-3(2)7-5(11)8-4/h1H,(H3,6,7,8,9,10,11)/i1+1,6+1,9+1 |
| Storage |
+4 °C |
| Accurate Mass |
155.0309 |
| API Family |
Allopurinol |
| Format |
Neat |
| Shipping Temperature |
Room temperature |
| SIL Type |
Nitrogen, Carbon |
| Unlabeled CAS |
2465-59-0 |
Please kindly note that our products and services are for research use only.
