| Catalog Number |
ACM1219804111 |
| CAS |
1219804-11-1 |
| Structure |
 |
| IUPAC Name |
2-[2-(1,1,2,2,2-pentadeuterioethoxy)ethoxy]ethanol |
| Molecular Weight |
139.21 |
| Molecular Formula |
C6H9D5O3 |
| InChI |
InChI=1S/C6H14O3/c1-2-8-5-6-9-4-3-7/h7H,2-6H2,1H3/i1D3,2D2 |
| InChI Key |
XXJWXESWEXIICW-ZBJDZAJPSA-N |
| Chemical Formula |
HOCH2CH2OCH2CH2OCD2CD3 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])OCCOCCO |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
111-90-0 |
| Unlabeled Synonyms |
2-(2-Ethoxyethoxy)ethanol |
