| Catalog Number |
ACM52089620-1 |
| CAS |
52089-62-0 |
| Structure |
 |
| Synonyms |
Butanedioic-d4 acid; Diethyl succinate-2,2,3,3-D4 |
| IUPAC Name |
diethyl 2,2,3,3-tetradeuteriobutanedioate |
| Molecular Weight |
178.22 |
| Molecular Formula |
C8H10D4O4 |
| InChI |
InChI=1S/C8H14O4/c1-3-11-7(9)5-6-8(10)12-4-2/h3-6H2,1-2H3/i5D2,6D2 |
| InChI Key |
DKMROQRQHGEIOW-NZLXMSDQSA-N |
| Boiling Point |
218 °C (lit.) |
| Melting Point |
-20 °C (lit.) |
| Flash Point |
212 °F |
| Density |
1.050 g/mL at 25 °C |
| Chemical Formula |
CH3CH2OOC(CD2)2COOCH2CH3 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C(=O)OCC)C([2H])([2H])C(=O)OCC |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
123-25-1 |
| Unlabeled Synonyms |
Ethyl succinate, Diethyl butanedioate |
