| Catalog Number |
ACM93952126-2 |
| CAS |
93952-12-6 |
| Structure |
 |
| Description |
Diethyl phthalate-d4 is the deuterium labeled Diethyl phthalate. Diethyl phthalate can be used as plasticizer, solvent, lubricant, fixative, foaming agent for non-ferrous or rare metal mine flotation, gas chromatography stationary solution, alcohol denaturant, spray insecticide. |
| Molecular Weight |
226.26 |
| Molecular Formula |
C12H10D4O4 |
| Canonical SMILES |
CCOC(C1=C(C([2H])=C([2H])C([2H])=C1[2H])C(OCC)=O)=O |
| Purity |
0.9854 |
| Appearance |
Liquid |
| Storage |
Pure form: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
