| Catalog Number |
ACM93952126-1 |
| CAS |
93952-12-6 |
| Structure |
 |
| Synonyms |
Ethyl Phthalate; Phthalic Acid Diethyl Ester |
| IUPAC Name |
diethyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| Molecular Weight |
226.26 |
| Molecular Formula |
C6D4(COOCH2CH3)2 |
| InChI |
InChI=1S/C12H14O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h5-8H,3-4H2,1-2H3/i5D,6D,7D,8D |
| InChI Key |
FLKPEMZONWLCSK-KDWZCNHSSA-N |
| Boiling Point |
298-299 °C (lit.) |
| Melting Point |
-3 °C (lit.) |
| Flash Point |
320 °F |
| Density |
1.158 g/mL at 25 °C |
| Appearance |
Neat |
| Chemical Formula |
C6D4(COOCH2CH3)2 |
| Functional Group |
Esters & Lactones |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])C(=O)OCC)C(=O)OCC)[2H])[2H] |
| Isotopic Enrichment |
99 atom % D |
| Packaging |
0.1 g
In Stock
0.25 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
84-66-2 |
| Unlabeled Synonyms |
Ethylmalonate; Propanedioic acid diethyl ester |
