| Catalog Number |
ACM4303495 |
| CAS |
4303-49-5 |
| Structure |
 |
| Synonyms |
Diethyl malonate-2,2-D2 |
| IUPAC Name |
diethyl 2,2-dideuteriopropanedioate |
| Molecular Weight |
162.18 |
| Molecular Formula |
C7H10D2O4 |
| Canonical SMILES |
CCOC(=O)CC(=O)OCC |
| InChI |
InChI=1S/C7H12O4/c1-3-10-6(8)5-7(9)11-4-2/h3-5H2,1-2H3/i5D2 |
| InChI Key |
IYXGSMUGOJNHAZ-BFWBPSQCSA-N |
| Boiling Point |
199 °C (lit.) |
| Melting Point |
-51--50 °C (lit.) |
| Flash Point |
212 °F |
| Purity |
98 atom % D |
| Density |
1.068 g/mL at 25 °C |
| Chemical Formula |
CD2(COOCH2CH3)2 |
| Exact Mass |
162.08600 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C(=O)OCC)C(=O)OCC |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
105-53-3 |
| Unlabeled Synonyms |
Ethylmalonate; Propanedioic acid diethyl ester |
