Diclofenac D4 acid (phenyl D4) 100 µg/mL in Acetone
| Catalog Number |
ACM153466650-2 |
| CAS |
153466-65-0 |
| Structure |
 |
| Synonyms |
6-[(2,6-Dichlorophenyl)amino]-benzen-2,3,4,5-d4-acetic acid, Diclofenac D4 acid (phenyl D4), Diclofenac (phenyl D4) |
| IUPAC Name |
2-[2,3,4,5-tetradeuterio-6-(2,6-dichloroanilino)phenyl]acetic acid |
| Molecular Weight |
300.17 |
| Molecular Formula |
C14D4H7Cl2NO2 |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c(Nc2c(Cl)cccc2Cl)c(CC(=O)O)c1[2H] |
| InChI |
InChI=1S/C14H11Cl2NO2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7,17H,8H2,(H,18,19)/i1D,2D,4D,7D |
| Storage |
+20 °C |
| Accurate Mass |
299.0418 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
15307-86-5 |
Please kindly note that our products and services are for research use only.
