Dichlorvos D6 (dimethyl D6)
| Catalog Number |
ACM203645538-2 |
| CAS |
203645-53-8 |
| Structure |
 |
| Synonyms |
Phosphoric acid, 2,2-dichloroethenyl di(methyl-d3) ester, 2,2-Dichloroethenyl di(methyl-d3) phosphate, Dichlorvos D6 (dimethyl D6), Dichlorvos-d6 |
| IUPAC Name |
2,2-dichloroethenyl bis(trideuteriomethyl) phosphate |
| Molecular Weight |
227.01 |
| Molecular Formula |
C4D6HCl2O4P |
| Canonical SMILES |
[2H]C([2H])([2H])OP(=O)(OC=C(Cl)Cl)OC([2H])([2H])[2H] |
| InChI |
InChI=1S/C4H7Cl2O4P/c1-8-11(7,9-2)10-3-4(5)6/h3H,1-2H3/i1D3,2D3 |
| Storage |
-18 °C |
| Accurate Mass |
225.9836 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
62-73-7 |
Please kindly note that our products and services are for research use only.
