Dibromocyanoacetamide-13C3
| Catalog Number |
ACM1286131381 |
| CAS |
1286131-38-1 |
| Synonyms |
2,2-Dibromo-3-nitrilopropanamide-13C3 |
| IUPAC Name |
2-(azanylidyne(1-13C)methyl)-2,2-dibromoacetamide |
| Molecular Weight |
244.85 |
| Molecular Formula |
13C3H2Br2N2O |
| InChI |
InChI=1S/C3H2Br2N2O/c4-3(5,1-6)2(7)8/h(H2,7,8)/i1+1,2+1,3+1 |
| InChI Key |
UUIVKBHZENILKB-VMIGTVKRSA-N |
| Melting Point |
115-118 °C |
| Appearance |
Orange solid |
| Format |
Neat |
| Isomeric SMILES |
[13C](#N)[13C]([13C](=O)N)(Br)Br |
| Shipping Temperature |
Room temperature |
| Storage Conditions |
2-8 °C Fridge/Coldroom |
| Unlabeled CAS |
10222-01-2 |
Please kindly note that our products and services are for research use only.
