| Catalog Number |
ACM33262292 |
| CAS |
33262-29-2 |
| Structure |
 |
| Synonyms |
Dibenzothiofuran; Diphenylene Sulfide |
| IUPAC Name |
1,2,3,4,6,7,8,9-octadeuteriodibenzothiophene |
| Molecular Weight |
192.3 |
| Molecular Formula |
C12D8S |
| Canonical SMILES |
C1=CC=C2C(=C1)C3=CC=CC=C3S2 |
| InChI Key |
IYYZUPMFVPLQIF-PGRXLJNUSA-N |
| Boiling Point |
323-333ºC |
| Melting Point |
97-100ºC(lit.) |
| Purity |
98 atom % D |
| Exact Mass |
192.08500 |
| Functional Group |
Heterocycles,Sulfur Containing Compounds |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.1 g
In Stock
0.25 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
132-65-0 |
