| Catalog Number |
ACM203578329-1 |
| CAS |
203578-32-9 |
| Structure |
 |
| Synonyms |
Dibutylamine; N-Butyl-1-butanamine |
| IUPAC Name |
1,1,2,2,3,3,4,4,4-nonadeuterio-N-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)butan-1-amine |
| Molecular Weight |
147.35 |
| Molecular Formula |
C8D18HN |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])NC([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C8H19N/c1-3-5-7-9-8-6-4-2/h9H,3-8H2,1-2H3/i1D3,2D3,3D2,4D2,5D2,6D2,7D2,8D2 |
| Purity |
98 atom % D |
| Accurate Mass |
147.2647 |
| Format |
Neat |
| Functional Group |
Amines & Amine Salts |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.05 g
In Stock
0.1 g
In Stock |
| Shipping Hazards |
CORROSIVE & FLAMMABLE LIQUID |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
111-92-2 |
