| Catalog Number |
ACM70237411-1 |
| CAS |
70237-41-1 |
| Structure |
 |
| Synonyms |
N-(1-Methylethyl)-2-propanamine Hydrochloride-d14, Dimethyldiethylamine Hydrochloride-d14, Diisopropylamine Hydrochloride-d14, Bis(isopropyl)ammonium Chloride-d14, Diisopropylammonium Chloride-d14 |
| IUPAC Name |
bis(propan-2-yl-d7)amine |
| Molecular Weight |
115.28 |
| Molecular Formula |
C6HD14N |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C6H15N/c1-5(2)7-6(3)4/h5-7H,1-4H3/i1D3,2D3,3D3,4D3,5D,6D |
| Purity |
98 atom % D |
| Accurate Mass |
115.21 |
| Format |
Neat |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.25 g
In Stock
0.5 g
In Stock |
| Shipping Hazards |
FLAMMABLE LIQUID & CORROSIVE |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
1219803-88-9 |
