Desethyldesisopropyl Atrazine-13C3
| Catalog Number |
ACM1216850337 |
| CAS |
1216850-33-7 |
| Structure |
 |
| IUPAC Name |
6-chloro-(2,4,6-^{13}C_{3})1,3,5-triazine-2,4-diamine |
| Molecular Weight |
148.53 |
| Molecular Formula |
13C3H4ClN5 |
| Canonical SMILES |
N[13c]1n[13c](N)n[13c](Cl)n1 |
| InChI |
InChI=1S/C3H4ClN5/c4-1-7-2(5)9-3(6)8-1/h(H4,5,6,7,8,9)/i1+1,2+1,3+1 |
| Storage |
-20 °C |
| Accurate Mass |
148.0256 |
| Format |
Neat |
| Shipping Temperature |
Room temperature |
| SIL Type |
Carbon |
| Unlabeled CAS |
3397-62-4 |
Please kindly note that our products and services are for research use only.
