Demeton-S-methyl D6 (dimethyl D6) 100 µg/mL in Cyclohexane
| Catalog Number |
ACM2733153836 |
| CAS |
2733153-83-6 |
| Structure |
 |
| Synonyms |
Demeton-S-methyl D6 (dimethyl D6) |
| IUPAC Name |
1-[bis(trideuteriomethoxy)phosphorylsulfanyl]-2-ethylsulfanylethane |
| Molecular Weight |
236.32 |
| Molecular Formula |
C6D6H9O3PS2 |
| Canonical SMILES |
[2H]C([2H])([2H])OP(=O)(OC([2H])([2H])[2H])SCCSCC |
| InChI |
InChI=1S/C6H15O3PS2/c1-4-11-5-6-12-10(7,8-2)9-3/h4-6H2,1-3H3/i2D3,3D3 |
| Storage |
+20 °C |
| Accurate Mass |
236.0577 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
