4,4'-DDE D8 100 µg/mL in Acetone
| Catalog Number |
ACM93952193-1 |
| CAS |
93952-19-3 |
| Structure |
 |
| IUPAC Name |
1-chloro-2,3,5,6-tetradeuterio-4-[2,2-dichloro-1-(4-chloro-2,3,5,6-tetradeuteriophenyl)ethenyl]benzene |
| Molecular Weight |
326.07 |
| Molecular Formula |
C14D8Cl4 |
| Canonical SMILES |
[2H]c1c([2H])c(C(=C(Cl)Cl)c2c([2H])c([2H])c(Cl)c([2H])c2[2H])c([2H])c([2H])c1Cl |
| InChI |
InChI=1S/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D |
| Storage |
+20 °C |
| Accurate Mass |
323.9882 |
| Alternative CAS |
72-55-9 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
