| Catalog Number |
ACM944386474-1 |
| CAS |
944386-47-4 |
| Description |
D-Tyrosine-d4 is the deuterium labeled D-Tyrosine. D-tyrosine-d4 is deuterium-labeled D-tyrosine. D-tyrosine is the D-isomer of tyrosine. D-tyrosine negatively regulates melanin synthesis by inhibiting tyrosinase activity. D-tyrosine inhibits biofilm formation and triggers self-dispersion of biofilms without inhibiting bacterial growth and can be used in biological research. |
| Molecular Weight |
185.21 |
| Molecular Formula |
C9H7D4NO3 |
| Canonical SMILES |
OC([C@H](N)CC1=C([2H])C([2H])=C(C([2H])=C1[2H])O)=O |
| Purity |
≥99.0% |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
