D-Phenyl-d5-alanine-2,3,3-d3
| Catalog Number |
ACM1202064025 |
| CAS |
1202064-02-5 |
| IUPAC Name |
(E)-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-3-(furan-2-yl)prop-2-enenitrile |
| Molecular Weight |
173.24 |
| Molecular Formula |
C9H3D8NO2 |
| Canonical SMILES |
CC1=C(SC2=C1C(=O)NC(=N2)C(=CC3=CC=CO3)C#N)C |
| InChI Key |
FIVBERIGFCDIKR-UXBLZVDNSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
C6D5CD2CD(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
673-06-3 |
| Unlabeled Synonyms |
(R)-2-Amino-3-phenylpropionic acid; H-D-Phe-OH |
Please kindly note that our products and services are for research use only.
