| Catalog Number |
ACM133665482-1 |
| CAS |
133665-48-2 |
| Structure |
 |
| Synonyms |
D-Alanine-3-13C |
| IUPAC Name |
(2R)-2-amino(3-13C)propanoic acid |
| Molecular Weight |
90.09 |
| Molecular Formula |
13CC2H7NO2 |
| Canonical SMILES |
[13CH3][C@H](C(=O)O)N |
| InChI |
InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m1/s1/i1+1 |
| InChI Key |
QNAYBMKLOCPYGJ-DOCFYQGNSA-N |
| Melting Point |
291 °C (556 °F) |
| Purity |
98% |
| Appearance |
White to off-white solid |
| Chemical Formula |
*CH3CH(NH2)COOH |
| Isotopic Enrichment |
99 atom % 13C |
| Unlabeled CAS |
338-69-2 |
| Unlabeled Synonyms |
(R)- 2-Aminopropionic acid |
Please kindly note that our products and services are for research use only.
