| Catalog Number |
ACM106391246 |
| CAS |
106391-24-6 |
| Structure |
 |
| Synonyms |
Cytosine-d2 |
| IUPAC Name |
6-amino-4,5-dideuterio-1H-pyrimidin-2-one |
| Molecular Weight |
113.12 |
| Molecular Formula |
C4H3D2N3O |
| InChI |
InChI=1S/C4H5N3O/c5-3-1-2-6-4(8)7-3/h1-2H,(H3,5,6,7,8)/i1D,2D |
| InChI Key |
OPTASPLRGRRNAP-QDNHWIQGSA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(NC(=O)N=C1[2H])N |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
71-30-7 |
| Unlabeled Synonyms |
4-Amino-2-hydroxypyrimidine; 4-Amino-2(1H)-pyrimidinone |
