| Catalog Number |
ACM2411870794 |
| CAS |
2411870-79-4 |
| Description |
Cyhalothrin-d5 is the deuterium labeled Cyhalothrin. Cyhalothrin is a pyrethroid pesticide that is generally stable to the environment, slow to degrade, and has a low degradation rate during processing. Its half-life is 4 to 16 weeks. |
| Molecular Weight |
454.88 |
| Molecular Formula |
C23H14D5ClF3NO3 |
| Canonical SMILES |
FC(F)(F)/C(Cl)=C/C1C(C1(C)C)C(OC(C2=CC(OC3=C([2H])C([2H])=C([2H])C([2H])=C3[2H])=CC=C2)C#N)=O |
| Purity |
≥98.0% |
| Appearance |
Liquid |
| Storage |
Solution, -20℃, 2 years |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
Please kindly note that our products and services are for research use only.
