| Catalog Number |
ACM93131169 |
| CAS |
93131-16-9 |
| Structure |
 |
| Synonyms |
Cyclohexane-1-carboxylic-D11 acid |
| IUPAC Name |
1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane-1-carboxylic acid |
| Molecular Weight |
139.24 |
| Molecular Formula |
C7HD11O2 |
| InChI |
InChI=1S/C7H12O2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2,(H,8,9)/i1D2,2D2,3D2,4D2,5D2,6D |
| InChI Key |
NZNMSOFKMUBTKW-KAFHOZLVSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
C6D11COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])C(=O)O)([2H])[2H])([2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
98-89-5 |
| Unlabeled Synonyms |
Hexahydrobenzoic acid |
