Coumarin D4 (5,6,7,8 D4) 100 µg/mL in Acetone
| Catalog Number |
ACM185056831-2 |
| CAS |
185056-83-1 |
| Structure |
 |
| Synonyms |
2H-1-Benzopyran-2-one-5,6,7,8-d4 (9CI), Coumarin 5,6,7,8-D4, Coumarin-d4 |
| IUPAC Name |
5,6,7,8-tetradeuteriochromen-2-one |
| Molecular Weight |
150.17 |
| Molecular Formula |
C9D4H2O2 |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c2C=CC(=O)Oc2c1[2H] |
| InChI |
InChI=1S/C9H6O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H/i1D,2D,3D,4D |
| Storage |
+20 °C |
| Accurate Mass |
150.0619 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
91-64-5 |
Please kindly note that our products and services are for research use only.
