Coumaphos D10 di(ethyl-D5) 100 µg/mL in Acetonitrile
| Catalog Number |
ACM287397868-1 |
| CAS |
287397-86-8 |
| Structure |
 |
| Synonyms |
Coumaphos D10 (di(ethyl-D5)) |
| IUPAC Name |
7-[bis(1,1,2,2,2-pentadeuterioethoxy)phosphinothioyloxy]-3-chloro-4-methylchromen-2-one |
| Molecular Weight |
372.83 |
| Molecular Formula |
C14D10H6ClO5PS |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])([2H])OP(=S)(Oc1ccc2C(=C(Cl)C(=O)Oc2c1)C)OC([2H])([2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C14H16ClO5PS/c1-4-17-21(22,18-5-2)20-10-6-7-11-9(3)13(15)14(16)19-12(11)8-10/h6-8H,4-5H2,1-3H3/i1D3,2D3,4D2,5D2 |
| Storage |
+20 °C |
| Accurate Mass |
372.0772 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
56-72-4 |
Please kindly note that our products and services are for research use only.
