| Catalog Number |
ACM73565874 |
| CAS |
73565-87-4 |
| Structure |
 |
| Synonyms |
(11β)-11,17,21-Trihydroxy-pregn-4-ene-3,20-dione-d4 |
| IUPAC Name |
(8S,10R,11S,13S)-9,11,12,12-tetradeuterio-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| Molecular Weight |
366.49 |
| Molecular Formula |
C21H26D4O5 |
| InChI |
InChI=1S/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-16,18,22,24,26H,3-8,10-11H2,1-2H3/t14-,15?,16-,18?,19-,20-,21?/m0/s1/i10D2,16D,18D |
| InChI Key |
JYGXADMDTFJGBT-LTVXCZLVSA-N |
| Melting Point |
211-214 °C |
| Appearance |
White solid |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H][C@@]1(C([C@]2(C(CCC2(C(=O)CO)O)[C@H]3C1([C@]4(CCC(=O)C=C4CC3)C)[2H])C)([2H])[2H])O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
50-23-7 |
| Unlabeled Synonyms |
Hydrocortisone; 11β,17α,21-Trihydroxypregn-4-ene-3,20-dione; 17-Hydroxycorticosterone |
