Clonidine:HCl (4,4,5,5-Imidazoline-D4)
| Catalog Number |
ACM67151024-1 |
| CAS |
67151-02-4 |
| Structure |
 |
| Synonyms |
Clonidine-D4 hydrochloride |
| IUPAC Name |
4,4,5,5-tetradeuterio-N-(2,6-dichlorophenyl)-1H-imidazol-2-amine;hydrochloride |
| Molecular Weight |
270.58 |
| Molecular Formula |
C9H6Cl3D4N3 |
| InChI |
InChI=1S/C9H9Cl2N3.ClH/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9;/h1-3H,4-5H2,(H2,12,13,14);1H/i4D2,5D2; |
| InChI Key |
ZNIFSRGNXRYGHF-HGFPCDIYSA-N |
| Melting Point |
130 °C (266 °F) |
| Purity |
95% |
| Solubility |
50 g/L |
| Appearance |
White solid |
| Isomeric SMILES |
[2H]C1(C(N=C(N1)NC2=C(C=CC=C2Cl)Cl)([2H])[2H])[2H].Cl |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
4205-91-8 |
Please kindly note that our products and services are for research use only.
