Clenpenterol D5 hydrochloride
| Catalog Number |
ACM1794793206-1 |
| CAS |
1794793-20-6 |
| Synonyms |
1-(4-Amino-3,5-dichlorophenyl)-2-[(3,3,4,4,4-pentadeuterio-2-methylbutan-2-yl)amino]ethanol hydrochloride, Clenpenterol-D5 hydrochloride, Clenpenterol-d5 hydrochloride (ethyl-d5) |
| IUPAC Name |
1-(4-amino-3,5-dichlorophenyl)-2-[(3,3,4,4,4-pentadeuterio-2-methylbutan-2-yl)amino]ethanol;hydrochloride |
| Molecular Weight |
332.71 |
| Molecular Formula |
C13D5H15Cl2N2O·ClH |
| Canonical SMILES |
Cl.[2H]C([2H])([2H])C([2H])([2H])C(C)(C)NCC(O)c1cc(Cl)c(N)c(Cl)c1 |
| Storage |
+4 °C |
| Accurate Mass |
331.1033 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
