| Catalog Number |
ACM147664833 |
| CAS |
147664-83-3 |
| Structure |
 |
| Synonyms |
2-Hydroxy-1,2,3-propanetricarboxylic Acid |
| IUPAC Name |
1,1,3,3-tetradeuterio-2-hydroxypropane-1,2,3-tricarboxylic acid |
| Molecular Weight |
196.15 |
| Molecular Formula |
HOOCCD2C(COOH)(OH)CD2COOH |
| Canonical SMILES |
C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
| InChI |
InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/i1D2,2D2 |
| InChI Key |
KRKNYBCHXYNGOX-LNLMKGTHSA-N |
| Boiling Point |
309.6ºC at 760 mmHg |
| Melting Point |
153-159 °C (lit.) |
| Flash Point |
155.2ºC |
| Purity |
98 atom % D |
| Density |
1.799g/cm³ |
| Appearance |
White solid |
| Chemical Formula |
HOOCCD2C(COOH)(OH)CD2COOH |
| Exact Mass |
196.05200 |
| Functional Group |
Alcohols & Phenols,Carboxylic Acids & Salts |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C(=O)O)C(C(=O)O)(C([2H])([2H])C(=O)O)O |
| Isotopic Enrichment |
98 atom % D |
| Odor |
Odourless |
| Packaging |
0.1 g
In Stock
0.25 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
77-92-9 |
| Unlabeled Synonyms |
2-Hydroxy-1,2,3-propanetricarboxylic acid |
