| Catalog Number |
ACM60816173 |
| CAS |
60816-17-3 |
| Structure |
 |
| Synonyms |
(26,26,26,27,27,27-2H6)Cholesterol |
| IUPAC Name |
(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-7,7,7-trideuterio-6-(trideuteriomethyl)heptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Molecular Weight |
392.70 |
| Molecular Formula |
C27H40D6O |
| InChI |
InChI=1S/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1/i1D3,2D3 |
| InChI Key |
HVYWMOMLDIMFJA-QSOBUISFSA-N |
| Boiling Point |
360 °C |
| Melting Point |
147-149 °C |
| Purity |
99 atom % D |
| Accurate Mass |
392.39 |
| Hazards |
Non-hazardous for transport. |
| Hygroscopic |
No |
| Isomeric SMILES |
[2H]C([2H])([2H])C(CCC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)C([2H])([2H])[2H] |
| Isotopic Enrichment |
99 atom % D |
| Light Sensitive |
No |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
57-88-5 |
| Unlabeled Synonyms |
5-Cholesten-3β-ol; 3β-Hydroxy-5-cholestene |
