| Catalog Number |
ACM285138810 |
| CAS |
285138-81-0 |
| Structure |
 |
| Description |
Chlorpyrifos-d10 is the deuterium labeled Chlorpyrifos. Chlorpyrifos has a slight mercaptan smell and is a non-systemic broad-spectrum insecticide and acaricide with high volatility in the land. |
| Molecular Weight |
360.65 |
| Molecular Formula |
C9HD10Cl3NO3PS |
| Canonical SMILES |
S=P(OC([2H])([2H])C([2H])([2H])[2H])(OC1=NC(Cl)=C(Cl)C=C1Cl)OC([2H])([2H])C([2H])([2H])[2H] |
| Purity |
≥98.0% |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
