| Catalog Number |
ACM344298846-1 |
| CAS |
344298-84-6 |
| Structure |
 |
| Synonyms |
Phen-2,3,5,6-d4-ol-d, 4-chloro- (9CI), 4-Chlorophenol-D5, p-Chlorophenol-d5 |
| IUPAC Name |
1-chloro-2,3,5,6-tetradeuterio-4-deuteriooxybenzene |
| Molecular Weight |
133.59 |
| Molecular Formula |
C6D5ClO |
| Canonical SMILES |
[2H]Oc1c([2H])c([2H])c(Cl)c([2H])c1[2H] |
| InChI |
InChI=1S/C6H5ClO/c7-5-1-3-6(8)4-2-5/h1-4,8H/i1D,2D,3D,4D/hD |
| InChI Key |
WXNZTHHGJRFXKQ-HXRFYODMSA-N |
| Purity |
98 atom % D |
| Accurate Mass |
133.0343 |
| Exact Mass |
133.03400 |
| Format |
Neat |
| Functional Group |
Alcohols & Phenols,Halides |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.25 g
In Stock
0.5 g
In Stock |
| Shipping Hazards |
TOXIC (PGIII) |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
106-48-9 |
