| Catalog Number |
ACM347840113-1 |
| CAS |
347840-11-3 |
| Structure |
 |
| Synonyms |
3-Chlorobenzenamine-d3, 3-Chlorobenzen-2,4,6-d3-amine, 3-Chloroaniline-2,4,6-D3, 3-Chlorobenzen-2,4,6-d3-amine (ACI), 3-Chloro-2,4,6-trideuterioaniline, 3-Chloro-2,4,6-trideuteroaniline, 3-Chloroaniline D3 (2,4,6-phenyl D3) |
| IUPAC Name |
3-chloro-2,4,6-trideuterioaniline |
| Molecular Weight |
130.59 |
| Molecular Formula |
C6D3H3ClN |
| Canonical SMILES |
[2H]c1cc([2H])c(Cl)c([2H])c1N |
| InChI |
InChI=1S/C6H6ClN/c7-5-2-1-3-6(8)4-5/h1-4H,8H2/i2D,3D,4D |
| InChI Key |
PNPCRKVUWYDDST-NRUYWUNFSA-N |
| Purity |
98 atom % D |
| Accurate Mass |
130.0377 |
| Exact Mass |
130.03800 |
| Format |
Neat |
| Functional Group |
Amines & Amine Salts,Halides |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.25 g
In Stock
0.5 g
In Stock |
| Shipping Hazards |
TOXIC |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
108-42-9 |
