3-Chloro-1,2-propanediol D5
| Catalog Number |
ACM342611012-1 |
| CAS |
342611-01-2 |
| Structure |
 |
| Synonyms |
3-MCPD D5, 3-chloro-1,2-propane-1,1,2,3,3-d5-diol |
| IUPAC Name |
3-chloro-1,1,2,3,3-pentadeuteriopropane-1,2-diol |
| Molecular Weight |
115.57 |
| Molecular Formula |
C3D5H2ClO2 |
| Canonical SMILES |
[2H]C([2H])(O)C([2H])(O)C([2H])([2H])Cl |
| InChI |
InChI=1S/C3H7ClO2/c4-1-3(6)2-5/h3,5-6H,1-2H2/i1D2,2D2,3D |
| Storage |
+20 °C |
| Accurate Mass |
115.0448 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
96-24-2 |
Please kindly note that our products and services are for research use only.
