Chlormequat chloride D4 (1,1,2,2 D4)
| Catalog Number |
ACMA00064948 |
| Synonyms |
Chlormequat-chloride 1,1,2,2-D4, Chlormequat Chloride D4 (chloroethyl D4), Chlormequat chloride-d4 |
| IUPAC Name |
(2-chloro-1,1,2,2-tetradeuterioethyl)-trimethylazanium;chloride |
| Molecular Weight |
162.09 |
| Molecular Formula |
C5D4H9ClN·Cl |
| Canonical SMILES |
[Cl-].[2H]C([2H])(Cl)C([2H])([2H])[N+](C)(C)C |
| Storage |
+20 °C |
| Accurate Mass |
161.0676 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
