Chloramphenicol D5 (ring D4, benzyl D) 100 µg/mL in Acetonitrile
| Catalog Number |
ACM202480680-1 |
| CAS |
202480-68-0 |
| Structure |
 |
| IUPAC Name |
2,2-dichloro-N-[(1R,2R)-1-deuterio-1,3-dihydroxy-1-(2,3,5,6-tetradeuterio-4-nitrophenyl)propan-2-yl]acetamide |
| Molecular Weight |
328.16 |
| Molecular Formula |
C11D5H7Cl2N2O5 |
| Canonical SMILES |
[2H]c1c([2H])c(c([2H])c([2H])c1[N+](=O)[O-])[C@@]([2H])(O)[C@@H](CO)NC(=O)C(Cl)Cl |
| InChI |
InChI=1S/C11H12Cl2N2O5/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20/h1-4,8-10,16-17H,5H2,(H,14,18)/t8-,9-/m1/s1/i1D,2D,3D,4D,9D |
| Storage |
+20 °C |
| Accurate Mass |
327.0437 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
