| Catalog Number |
ACM202480680 |
| CAS |
202480-68-0 |
| Structure |
 |
| Description |
Chloramphenicol-d5 is the deuterium labeled Chloramphenicol. Chloramphenicol antibiotics can act on the 50S subunit of bacterial ribonucleosomes and block protein synthesis. They are bacteriostatic broad-spectrum antibiotics. |
| Molecular Weight |
328.16 |
| Molecular Formula |
C11H7D5Cl2N2O5 |
| Canonical SMILES |
O=C(N[C@H](CO)[C@@](O)([2H])C1=C([2H])C([2H])=C([N+]([O-])=O)C([2H])=C1[2H])C(Cl)Cl |
| Purity |
0.9963 |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
