Butyraldehyde 2,4-dinitrophenylhydrazone-d3
| Catalog Number |
ACM259824549-1 |
| CAS |
259824-54-9 |
| Structure |
 |
| Description |
Butyraldehyde 2,4-dinitrophenylhydrazone-d3 is the deuterium labeled Butyraldehyde 2,4-dinitrophenylhydrazone. |
| Molecular Weight |
255.25 |
| Molecular Formula |
C10H9D3N4O4 |
| Canonical SMILES |
CCC/C=N/NC1=C([N+]([O-])=O)C([2H])=C([N+]([O-])=O)C([2H])=C1[2H] |
| Purity |
≥99.0% |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
Please kindly note that our products and services are for research use only.
