| Catalog Number |
ACM24313506-1 |
| CAS |
24313-50-6 |
| Structure |
 |
| Synonyms |
2-Butanone-1,1,1,3,3-d5 (6CI,8CI,9CI), 2-Butanone-d5 |
| IUPAC Name |
1,1,1,3,3-pentadeuteriobutan-2-one |
| Molecular Weight |
77.14 |
| Molecular Formula |
C4D5H3O |
| Canonical SMILES |
[2H]C([2H])([2H])C(=O)C([2H])([2H])C |
| InChI |
InChI=1S/C4H8O/c1-3-4(2)5/h3H2,1-2H3/i2D3,3D2 |
| Purity |
98 atom % D |
| Accurate Mass |
77.0889 |
| Format |
Neat |
| Functional Group |
Ketones & Ketals |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
1 g
In Stock |
| Shipping Hazards |
FLAMMABLE LIQUID |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
78-93-3 |
