Bromacil D3 (methyl D3) 100 µg/mL in Acetonitrile
| Catalog Number |
ACM2714436925 |
| CAS |
2714436-92-5 |
| Structure |
 |
| Synonyms |
Bromacil D3 (methyl D3) |
| IUPAC Name |
5-bromo-3-butan-2-yl-6-(trideuteriomethyl)-1H-pyrimidine-2,4-dione |
| Molecular Weight |
264.13 |
| Molecular Formula |
C9D3H10BrN2O2 |
| Canonical SMILES |
[2H]C([2H])([2H])C1=C(Br)C(=O)N(C(C)CC)C(=O)N1 |
| InChI |
InChI=1S/C9H13BrN2O2/c1-4-5(2)12-8(13)7(10)6(3)11-9(12)14/h5H,4H2,1-3H3,(H,11,14)/i3D3 |
| Storage |
+20 °C |
| Accurate Mass |
263.0349 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
