| Catalog Number |
ACM352534931-1 |
| CAS |
352534-93-1 |
| Structure |
 |
| IUPAC Name |
1,1,3,3-tetradeuterio-1,3-dideuteriooxy-2-[dideuterio(deuteriooxy)methyl]-N,N-bis(1,1,2,2-tetradeuterio-2-deuteriooxyethyl)propan-2-amine |
| Molecular Weight |
228.36 |
| Molecular Formula |
C8D19NO5 |
| InChI |
InChI=1S/C8H19NO5/c10-3-1-9(2-4-11)8(5-12,6-13)7-14/h10-14H,1-7H2/i1D2,2D2,3D2,4D2,5D2,6D2,7D2,10D,11D,12D,13D,14D |
| InChI Key |
OWMVSZAMULFTJU-ZMHMTVDGSA-N |
| Melting Point |
104°C (lit.) |
| Chemical Formula |
(DOCD2CD2)2NC(CD2OD)3 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C([2H])([2H])O[2H])N(C([2H])([2H])C([2H])([2H])O[2H])C(C([2H])([2H])O[2H])(C([2H])([2H])O[2H])C([2H])([2H])O[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
6976-37-0 |
| Unlabeled Synonyms |
2,2-Bis(Hydroxymethyl)-2,2',2"-nitrilotriethanol; Bis(2-Hydroxyethyl)amino-tris(hydroxymethyl)methane |
