| Catalog Number |
ACM93952024-1 |
| CAS |
93952-02-4 |
| Structure |
 |
| Synonyms |
Ethane-1,1,2,2-d4, 1,1'-oxybis[2-chloro- (9CI) |
| IUPAC Name |
1-chloro-2-(2-chloro-1,1,2,2-tetradeuterio-ethoxy)-1,1,2,2-tetradeuterio-ethane |
| Molecular Weight |
151.06 |
| Molecular Formula |
C4D8Cl2O |
| Canonical SMILES |
[2H]C([2H])(Cl)C([2H])([2H])OC([2H])([2H])C([2H])([2H])Cl |
| InChI |
InChI=1S/C4H8Cl2O/c5-1-3-7-4-2-6/h1-4H2/i1D2,2D2,3D2,4D2 |
| Accurate Mass |
150.0454 |
| Format |
Neat |
| Functional Group |
Ethers & Oxides |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.05 g
In Stock
0.1 g
In Stock |
| Shipping Hazards |
TOXIC & FLAMMABLE LIQUID |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
111-44-4 |
