Bis(2-chloroethyl)-1,1,2,2-d4-amine HCl (98 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM352431062-1 |
| CAS |
352431-06-2 |
| Structure |
 |
| Synonyms |
Ethan-1,1,2,2-d4-amine, 2-chloro-N-(2-chloroethyl)-, hydrochloride (9CI), Bis(2-chloroethyl)-1,1,2,2-tetradeuterioamine hydrochloride |
| IUPAC Name |
2-chloro-N-(2-chloroethyl)-1,1,2,2-tetradeuterioethanamine;hydrochloride |
| Molecular Weight |
182.51 |
| Molecular Formula |
C4D4H5Cl2N·ClH |
| Canonical SMILES |
Cl.[2H]C([2H])(Cl)C([2H])([2H])NCCCl |
| InChI |
InChI=1S/C4H9Cl2N.ClH/c5-1-3-7-4-2-6;/h7H,1-4H2;1H/i1D2,3D2; |
| Accurate Mass |
181.013 |
| Format |
Neat |
| SIL Type |
Deuterium |
| Unlabeled CAS |
821-48-7 |
Please kindly note that our products and services are for research use only.
