Bezafibrate D6 (dimethyl D6)
| Catalog Number |
ACM1219802740-2 |
| CAS |
1219802-74-0 |
| Structure |
 |
| Synonyms |
Bezafibrate D6 (dimethyl D6), 2-[4-[2-[(4-Chlorobenzoyl)amino]ethyl]phenoxy]-3,3,3-trideuterio-2-(trideuteriomethyl)propanoic acid |
| IUPAC Name |
2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-3,3,3-trideuterio-2-(trideuteriomethyl)propanoic acid |
| Molecular Weight |
367.86 |
| Molecular Formula |
C19D6H14ClNO4 |
| Canonical SMILES |
[2H]C([2H])([2H])C(Oc1ccc(CCNC(=O)c2ccc(Cl)cc2)cc1)(C(=O)O)C([2H])([2H])[2H] |
| InChI |
InChI=1S/C19H20ClNO4/c1-19(2,18(23)24)25-16-9-3-13(4-10-16)11-12-21-17(22)14-5-7-15(20)8-6-14/h3-10H,11-12H2,1-2H3,(H,21,22)(H,23,24)/i1D3,2D3 |
| Storage |
+20 °C |
| Accurate Mass |
367.1457 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
