| Catalog Number |
ACM71258236 |
| CAS |
71258-23-6 |
| Structure |
 |
| Synonyms |
Benzene-d5-methan-d2-ol |
| IUPAC Name |
dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methanol |
| Molecular Weight |
115.18 |
| Molecular Formula |
C7HD7O |
| InChI |
InChI=1S/C7H8O/c8-6-7-4-2-1-3-5-7/h1-5,8H,6H2/i1D,2D,3D,4D,5D,6D2 |
| InChI Key |
WVDDGKGOMKODPV-XZJKGWKKSA-N |
| Boiling Point |
203-205 °C (lit.) |
| Melting Point |
-16-13 °C (lit.) |
| Flash Point |
213 °F |
| Purity |
99 atom % D |
| Density |
1.113 g/mL at 25 °C |
| Chemical Formula |
C6D5CD2OH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])O)[2H])[2H] |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
100-51-6 |
| Unlabeled Synonyms |
Phenylcarbinol; Phenylmethanol |
