| Catalog Number |
ACM347840022-1 |
| CAS |
347840-02-2 |
| Structure |
 |
| Synonyms |
Benzyl-d5 cinnamate (E-isomer) |
| IUPAC Name |
(2,3,4,5,6-pentadeuteriophenyl)methyl (E)-3-phenylprop-2-enoate |
| Molecular Weight |
243.32 |
| Molecular Formula |
C16H9D5O2 |
| InChI |
InChI=1S/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2/b12-11+/i2D,5D,6D,9D,10D |
| InChI Key |
NGHOLYJTSCBCGC-MAOTZQGHSA-N |
| Chemical Formula |
C6H5CH=CHCOOCH2C6D5 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])COC(=O)/C=C/C2=CC=CC=C2)[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
103-41-3 |
| Unlabeled Synonyms |
Benzyl trans-3-phenylacrylate |
