| Catalog Number |
ACM1515861683 |
| CAS |
1515861-68-3 |
| IUPAC Name |
dimethyl-[(2,3,4,5,6-pentadeuteriophenyl)methyl]-tetradecylazanium;bromide |
| Molecular Weight |
417.53 |
| Molecular Formula |
C23H37D5BrN |
| InChI |
InChI=1S/C23H42N.BrH/c1-4-5-6-7-8-9-10-11-12-13-14-18-21-24(2,3)22-23-19-16-15-17-20-23;/h15-17,19-20H,4-14,18,21-22H2,1-3H3;1H/q+1;/p-1/i15D,16D,17D,19D,20D; |
| InChI Key |
CSNHNGDROQRZKT-DSVPTQILSA-M |
| Chemical Formula |
CH3(CH2)13N(Br)(CH3)2CH2C6D5 |
| Exact Mass |
416.28145 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])C[N+](C)(C)CCCCCCCCCCCCCC)[2H])[2H].[Br-] |
| Isotopic Enrichment |
99 atom % D |
| Monoisotopic Mass |
416.28145 |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Room temperature |
| Unlabeled CAS |
18773-88-1 |
| Unlabeled Synonyms |
Benzylmyristyldimethylammonium bromide; Miristalkonium bromide |
