Benzyl-2,3,4,5,6-d5 benzoate
| Catalog Number |
ACM347840011-1 |
| CAS |
347840-01-1 |
| Structure |
 |
| Synonyms |
Benzyl-d5 benzoate |
| IUPAC Name |
[dideuterio-(2,3,4-trideuteriophenyl)methyl] benzoate |
| Molecular Weight |
217.28 |
| Molecular Formula |
C14H7D5O2 |
| InChI |
InChI=1S/C14H12O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2/i1D,3D,7D,11D2 |
| InChI Key |
SESFRYSPDFLNCH-BHJVFHDNSA-N |
| Chemical Formula |
C6H5COOCH2C6D5 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C=C1)C([2H])([2H])OC(=O)C2=CC=CC=C2)[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
120-51-4 |
| Unlabeled Synonyms |
Benzoic acid benzyl ester |
Please kindly note that our products and services are for research use only.
